C10H16N2O3 — CID 130324063
methyl N-[3-[(2S)-2-methylpyrrolidin-1-yl]-3-oxoprop-1-en-2-yl]carbamate (PubChem CID 130324063) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is methyl N-[3-[(2S)-2-methylpyrrolidin-1-yl]-3-oxoprop-1-en-2-yl]carbamate.
| Compound Name | methyl N-[3-[(2S)-2-methylpyrrolidin-1-yl]-3-oxoprop-1-en-2-yl]carbamate |
|---|---|
| PubChem CID | 130324063 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | methyl N-[3-[(2S)-2-methylpyrrolidin-1-yl]-3-oxoprop-1-en-2-yl]carbamate |
| SMILES | C=C(NC(=O)OC)C(=O)N1CCC[C@@H]1C |
| InChI | InChI=1S/C10H16N2O3/c1-7-5-4-6-12(7)9(13)8(2)11-10(14)15-3/h7H,2,4-6H2,1,3H3,(H,11,14)/t7-/m0/s1 |
| InChIKey | YCMICFVVJKCPEZ-ZETCQYMHSA-N |
| XLogP | 0.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|