C15H18O2 — CID 130325377
3-[(1E,3E)-6-hydroxy-3-methylocta-1,3,7-trienyl]phenol (PubChem CID 130325377) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-[(1E,3E)-6-hydroxy-3-methylocta-1,3,7-trienyl]phenol.
| Compound Name | 3-[(1E,3E)-6-hydroxy-3-methylocta-1,3,7-trienyl]phenol |
|---|---|
| PubChem CID | 130325377 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 3-[(1E,3E)-6-hydroxy-3-methylocta-1,3,7-trienyl]phenol |
| SMILES | C=CC(O)C/C=C(C)/C=C/c1cccc(O)c1 |
| InChI | InChI=1S/C15H18O2/c1-3-14(16)10-8-12(2)7-9-13-5-4-6-15(17)11-13/h3-9,11,14,16-17H,1,10H2,2H3/b9-7+,12-8+ |
| InChIKey | YQGBONKRDDQQMM-BRVZEXMBSA-N |
| XLogP | 3.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|