C21H23F3 — CID 143875305
1-[(1E,3E,8Z)-8,9-difluoro-3,6,10-trimethyl-7-methylideneundeca-1,3,8,10-tetraenyl]-3-fluorobenzene (PubChem CID 143875305) has the molecular formula C21H23F3 and a molecular weight of 332.41 g/mol. Its IUPAC name is 1-[(1E,3E,8Z)-8,9-difluoro-3,6,10-trimethyl-7-methylideneundeca-1,3,8,10-tetraenyl]-3-fluorobenzene.
| Compound Name | 1-[(1E,3E,8Z)-8,9-difluoro-3,6,10-trimethyl-7-methylideneundeca-1,3,8,10-tetraenyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 143875305 |
| Molecular Formula | C21H23F3 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[(1E,3E,8Z)-8,9-difluoro-3,6,10-trimethyl-7-methylideneundeca-1,3,8,10-tetraenyl]-3-fluorobenzene |
| SMILES | C=C(C)/C(F)=C(/F)C(=C)C(C)C/C=C(C)/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C21H23F3/c1-14(2)20(23)21(24)17(5)16(4)11-9-15(3)10-12-18-7-6-8-19(22)13-18/h6-10,12-13,16H,1,5,11H2,2-4H3/b12-10+,15-9+,21-20- |
| InChIKey | BYWBOUPKKBLIJY-MCBPBUGFSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|