C18H10F4N2O4 — CID 130327526
6,13-diethyl-2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone (PubChem CID 130327526) has the molecular formula C18H10F4N2O4 and a molecular weight of 394.28 g/mol. Its IUPAC name is 6,13-diethyl-2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-diethyl-2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 130327526 |
| Molecular Formula | C18H10F4N2O4 |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 6,13-diethyl-2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
| SMILES | CCN1C(=O)c2c(F)c(F)c3c4c(c(F)c(F)c(c24)C1=O)C(=O)N(CC)C3=O |
| InChI | InChI=1S/C18H10F4N2O4/c1-3-23-15(25)7-5-6-9(13(21)11(7)19)17(27)24(4-2)18(28)10(6)14(22)12(20)8(5)16(23)26/h3-4H2,1-2H3 |
| InChIKey | ZQQRVSLTJNFMAT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|