C31H34N2O3 — CID 130327652
(3aS,10bS)-3a-benzyl-2-(4-butoxyphenyl)-5-propyl-6,10b-dihydro-[1,3]oxazolo[4,5-d][2]benzazepin-4-one (PubChem CID 130327652) has the molecular formula C31H34N2O3 and a molecular weight of 482.62 g/mol. Its IUPAC name is (3aS,10bS)-3a-benzyl-2-(4-butoxyphenyl)-5-propyl-6,10b-dihydro-[1,3]oxazolo[4,5-d][2]benzazepin-4-one.
| Compound Name | (3aS,10bS)-3a-benzyl-2-(4-butoxyphenyl)-5-propyl-6,10b-dihydro-[1,3]oxazolo[4,5-d][2]benzazepin-4-one |
|---|---|
| PubChem CID | 130327652 |
| Molecular Formula | C31H34N2O3 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | (3aS,10bS)-3a-benzyl-2-(4-butoxyphenyl)-5-propyl-6,10b-dihydro-[1,3]oxazolo[4,5-d][2]benzazepin-4-one |
| SMILES | CCCCOc1ccc(C2=N[C@]3(Cc4ccccc4)C(=O)N(CCC)Cc4ccccc4[C@@H]3O2)cc1 |
| InChI | InChI=1S/C31H34N2O3/c1-3-5-20-35-26-17-15-24(16-18-26)29-32-31(21-23-11-7-6-8-12-23)28(36-29)27-14-10-9-13-25(27)22-33(19-4-2)30(31)34/h6-18,28H,3-5,19-22H2,1-2H3/t28-,31-/m0/s1 |
| InChIKey | KEGKEEKTBAIEBN-IZEXYCQBSA-N |
| XLogP | 6.12 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|