C30H30Cl2N2O4 — CID 23920246
(4R,5'R)-5'-(2,4-dichlorophenyl)-2'-[4-(3-hydroxypropoxy)phenyl]-2-propylspiro[1,5-dihydro-2-benzazepine-4,4'-5H-1,3-oxazole]-3-one (PubChem CID 23920246) has the molecular formula C30H30Cl2N2O4 and a molecular weight of 553.49 g/mol. Its IUPAC name is (4R,5'R)-5'-(2,4-dichlorophenyl)-2'-[4-(3-hydroxypropoxy)phenyl]-2-propylspiro[1,5-dihydro-2-benzazepine-4,4'-5H-1,3-oxazole]-3-one.
| Compound Name | (4R,5'R)-5'-(2,4-dichlorophenyl)-2'-[4-(3-hydroxypropoxy)phenyl]-2-propylspiro[1,5-dihydro-2-benzazepine-4,4'-5H-1,3-oxazole]-3-one |
|---|---|
| PubChem CID | 23920246 |
| Molecular Formula | C30H30Cl2N2O4 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | (4R,5'R)-5'-(2,4-dichlorophenyl)-2'-[4-(3-hydroxypropoxy)phenyl]-2-propylspiro[1,5-dihydro-2-benzazepine-4,4'-5H-1,3-oxazole]-3-one |
| SMILES | CCCN1Cc2ccccc2C[C@]2(N=C(c3ccc(OCCCO)cc3)O[C@@H]2c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C30H30Cl2N2O4/c1-2-14-34-19-22-7-4-3-6-21(22)18-30(29(34)36)27(25-13-10-23(31)17-26(25)32)38-28(33-30)20-8-11-24(12-9-20)37-16-5-15-35/h3-4,6-13,17,27,35H,2,5,14-16,18-19H2,1H3/t27-,30-/m1/s1 |
| InChIKey | KCLLEIGABAZLSR-POURPWNDSA-N |
| XLogP | 6.01 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|