C27H26N2O4 — CID 23864396
(4S,5'S)-2'-[4-(3-hydroxypropoxy)phenyl]-5'-phenylspiro[2,5-dihydro-1H-2-benzazepine-4,4'-5H-1,3-oxazole]-3-one (PubChem CID 23864396) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is (4S,5'S)-2'-[4-(3-hydroxypropoxy)phenyl]-5'-phenylspiro[2,5-dihydro-1H-2-benzazepine-4,4'-5H-1,3-oxazole]-3-one.
| Compound Name | (4S,5'S)-2'-[4-(3-hydroxypropoxy)phenyl]-5'-phenylspiro[2,5-dihydro-1H-2-benzazepine-4,4'-5H-1,3-oxazole]-3-one |
|---|---|
| PubChem CID | 23864396 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (4S,5'S)-2'-[4-(3-hydroxypropoxy)phenyl]-5'-phenylspiro[2,5-dihydro-1H-2-benzazepine-4,4'-5H-1,3-oxazole]-3-one |
| SMILES | O=C1NCc2ccccc2C[C@@]12N=C(c1ccc(OCCCO)cc1)O[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H26N2O4/c30-15-6-16-32-23-13-11-20(12-14-23)25-29-27(24(33-25)19-7-2-1-3-8-19)17-21-9-4-5-10-22(21)18-28-26(27)31/h1-5,7-14,24,30H,6,15-18H2,(H,28,31)/t24-,27-/m0/s1 |
| InChIKey | UOLRUFVIDGNFHL-IGKIAQTJSA-N |
| XLogP | 3.58 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|