C24H28N2O4 — CID 23749361
(3R,5'R)-2'-[4-(3-hydroxypropoxy)phenyl]-5'-methyl-1-propylspiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one (PubChem CID 23749361) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (3R,5'R)-2'-[4-(3-hydroxypropoxy)phenyl]-5'-methyl-1-propylspiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one.
| Compound Name | (3R,5'R)-2'-[4-(3-hydroxypropoxy)phenyl]-5'-methyl-1-propylspiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one |
|---|---|
| PubChem CID | 23749361 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (3R,5'R)-2'-[4-(3-hydroxypropoxy)phenyl]-5'-methyl-1-propylspiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one |
| SMILES | CCCN1C(=O)[C@]2(Cc3ccccc31)N=C(c1ccc(OCCCO)cc1)O[C@@H]2C |
| InChI | InChI=1S/C24H28N2O4/c1-3-13-26-21-8-5-4-7-19(21)16-24(23(26)28)17(2)30-22(25-24)18-9-11-20(12-10-18)29-15-6-14-27/h4-5,7-12,17,27H,3,6,13-16H2,1-2H3/t17-,24-/m1/s1 |
| InChIKey | OUSHGGLYLFQNAX-MZNJEOGPSA-N |
| XLogP | 3.35 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|