C22H24BrNO5 — CID 23778081
methyl (4R,5R)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 23778081) has the molecular formula C22H24BrNO5 and a molecular weight of 462.34 g/mol. Its IUPAC name is methyl (4R,5R)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4R,5R)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 23778081 |
| Molecular Formula | C22H24BrNO5 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | methyl (4R,5R)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)[C@]1(Cc2ccccc2Br)N=C(c2ccc(OCCCO)cc2)O[C@@H]1C |
| InChI | InChI=1S/C22H24BrNO5/c1-15-22(21(26)27-2,14-17-6-3-4-7-19(17)23)24-20(29-15)16-8-10-18(11-9-16)28-13-5-12-25/h3-4,6-11,15,25H,5,12-14H2,1-2H3/t15-,22-/m1/s1 |
| InChIKey | YAZNECFXZVMBDV-IVZQSRNASA-N |
| XLogP | 3.53 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|