C27H24N2O5 — CID 23807427
(3S)-1-benzoyl-2'-[4-(3-hydroxypropoxy)phenyl]spiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one (PubChem CID 23807427) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is (3S)-1-benzoyl-2'-[4-(3-hydroxypropoxy)phenyl]spiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one.
| Compound Name | (3S)-1-benzoyl-2'-[4-(3-hydroxypropoxy)phenyl]spiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one |
|---|---|
| PubChem CID | 23807427 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (3S)-1-benzoyl-2'-[4-(3-hydroxypropoxy)phenyl]spiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one |
| SMILES | O=C(c1ccccc1)N1C(=O)[C@@]2(COC(c3ccc(OCCCO)cc3)=N2)Cc2ccccc21 |
| InChI | InChI=1S/C27H24N2O5/c30-15-6-16-33-22-13-11-19(12-14-22)24-28-27(18-34-24)17-21-9-4-5-10-23(21)29(26(27)32)25(31)20-7-2-1-3-8-20/h1-5,7-14,30H,6,15-18H2/t27-/m0/s1 |
| InChIKey | WOEDFRJPDZSDDC-MHZLTWQESA-N |
| XLogP | 3.39 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|