C33H28N2O5 — CID 23863755
(3R,5'R)-1-benzoyl-2'-[4-(3-hydroxypropoxy)phenyl]-5'-phenylspiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one (PubChem CID 23863755) has the molecular formula C33H28N2O5 and a molecular weight of 532.60 g/mol. Its IUPAC name is (3R,5'R)-1-benzoyl-2'-[4-(3-hydroxypropoxy)phenyl]-5'-phenylspiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one.
| Compound Name | (3R,5'R)-1-benzoyl-2'-[4-(3-hydroxypropoxy)phenyl]-5'-phenylspiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one |
|---|---|
| PubChem CID | 23863755 |
| Molecular Formula | C33H28N2O5 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (3R,5'R)-1-benzoyl-2'-[4-(3-hydroxypropoxy)phenyl]-5'-phenylspiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one |
| SMILES | O=C(c1ccccc1)N1C(=O)[C@]2(Cc3ccccc31)N=C(c1ccc(OCCCO)cc1)O[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C33H28N2O5/c36-20-9-21-39-27-18-16-24(17-19-27)30-34-33(29(40-30)23-10-3-1-4-11-23)22-26-14-7-8-15-28(26)35(32(33)38)31(37)25-12-5-2-6-13-25/h1-8,10-19,29,36H,9,20-22H2/t29-,33-/m1/s1 |
| InChIKey | NTVSXCUAZHBGBT-CYTLCNBWSA-N |
| XLogP | 5.13 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|