C29H28N2O6 — CID 23976212
(3R,5'R)-1-acetyl-2'-[4-(3-hydroxypropoxy)phenyl]-5'-(3-methoxyphenyl)spiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one (PubChem CID 23976212) has the molecular formula C29H28N2O6 and a molecular weight of 500.55 g/mol. Its IUPAC name is (3R,5'R)-1-acetyl-2'-[4-(3-hydroxypropoxy)phenyl]-5'-(3-methoxyphenyl)spiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one.
| Compound Name | (3R,5'R)-1-acetyl-2'-[4-(3-hydroxypropoxy)phenyl]-5'-(3-methoxyphenyl)spiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one |
|---|---|
| PubChem CID | 23976212 |
| Molecular Formula | C29H28N2O6 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | (3R,5'R)-1-acetyl-2'-[4-(3-hydroxypropoxy)phenyl]-5'-(3-methoxyphenyl)spiro[4H-quinoline-3,4'-5H-1,3-oxazole]-2-one |
| SMILES | COc1cccc([C@H]2OC(c3ccc(OCCCO)cc3)=N[C@]23Cc2ccccc2N(C(C)=O)C3=O)c1 |
| InChI | InChI=1S/C29H28N2O6/c1-19(33)31-25-10-4-3-7-22(25)18-29(28(31)34)26(21-8-5-9-24(17-21)35-2)37-27(30-29)20-11-13-23(14-12-20)36-16-6-15-32/h3-5,7-14,17,26,32H,6,15-16,18H2,1-2H3/t26-,29-/m1/s1 |
| InChIKey | DXQSUTITENHTMC-GGXMVOPNSA-N |
| XLogP | 3.85 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|