C30H30N2O4 — CID 23806703
(3aR,10bR)-5-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-3a-prop-2-enyl-6,10b-dihydro-[1,3]oxazolo[4,5-d][2]benzazepin-4-one (PubChem CID 23806703) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is (3aR,10bR)-5-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-3a-prop-2-enyl-6,10b-dihydro-[1,3]oxazolo[4,5-d][2]benzazepin-4-one.
| Compound Name | (3aR,10bR)-5-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-3a-prop-2-enyl-6,10b-dihydro-[1,3]oxazolo[4,5-d][2]benzazepin-4-one |
|---|---|
| PubChem CID | 23806703 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (3aR,10bR)-5-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-3a-prop-2-enyl-6,10b-dihydro-[1,3]oxazolo[4,5-d][2]benzazepin-4-one |
| SMILES | C=CC[C@@]12N=C(c3ccc(OCCCO)cc3)O[C@@H]1c1ccccc1CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C30H30N2O4/c1-2-17-30-27(36-28(31-30)23-13-15-25(16-14-23)35-19-8-18-33)26-12-7-6-11-24(26)21-32(29(30)34)20-22-9-4-3-5-10-22/h2-7,9-16,27,33H,1,8,17-21H2/t27-,30-/m1/s1 |
| InChIKey | VXGWFZDGVXDANO-POURPWNDSA-N |
| XLogP | 4.82 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|