C14H14N2O3 — CID 130328194
(6aS,8E)-8-ethylidene-2,3-dihydroxy-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 130328194) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is (6aS,8E)-8-ethylidene-2,3-dihydroxy-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS,8E)-8-ethylidene-2,3-dihydroxy-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 130328194 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (6aS,8E)-8-ethylidene-2,3-dihydroxy-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | C/C=C1\C[C@H]2C=Nc3cc(O)c(O)cc3C(=O)N2C1 |
| InChI | InChI=1S/C14H14N2O3/c1-2-8-3-9-6-15-11-5-13(18)12(17)4-10(11)14(19)16(9)7-8/h2,4-6,9,17-18H,3,7H2,1H3/b8-2+/t9-/m0/s1 |
| InChIKey | GLWXTGVEPRVVDN-WWQRDVDESA-N |
| XLogP | 1.97 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|