C22H21F4N3O5 — CID 130333645
(3R,5S)-5-ethyl-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-11-hydroxy-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide (PubChem CID 130333645) has the molecular formula C22H21F4N3O5 and a molecular weight of 483.42 g/mol. Its IUPAC name is (3R,5S)-5-ethyl-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-11-hydroxy-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | (3R,5S)-5-ethyl-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-11-hydroxy-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 130333645 |
| Molecular Formula | C22H21F4N3O5 |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | (3R,5S)-5-ethyl-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-11-hydroxy-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
| SMILES | CC[C@H]1CCN2C(=O)c3c(O)c(=O)c(C(=O)NCc4ccc(F)cc4C(F)(F)F)cn3C[C@H]2O1 |
| InChI | InChI=1S/C22H21F4N3O5/c1-2-13-5-6-29-16(34-13)10-28-9-14(18(30)19(31)17(28)21(29)33)20(32)27-8-11-3-4-12(23)7-15(11)22(24,25)26/h3-4,7,9,13,16,31H,2,5-6,8,10H2,1H3,(H,27,32)/t13-,16+/m0/s1 |
| InChIKey | IILLOYSLFPMPHI-XJKSGUPXSA-N |
| XLogP | 2.62 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |