C15H15N3O — CID 130335525
4-[[(6-methyl-1H-indazol-4-yl)amino]methyl]phenol (PubChem CID 130335525) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-[[(6-methyl-1H-indazol-4-yl)amino]methyl]phenol.
| Compound Name | 4-[[(6-methyl-1H-indazol-4-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 130335525 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-[[(6-methyl-1H-indazol-4-yl)amino]methyl]phenol |
| SMILES | Cc1cc(NCc2ccc(O)cc2)c2cn[nH]c2c1 |
| InChI | InChI=1S/C15H15N3O/c1-10-6-14(13-9-17-18-15(13)7-10)16-8-11-2-4-12(19)5-3-11/h2-7,9,16,19H,8H2,1H3,(H,17,18) |
| InChIKey | OHIVPHGHZYQCGP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |