C27H24N6O4 — CID 130336849
3-[6-[[[(6S,7aS)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl]amino]methyl]-2-pyridinyl]benzonitrile (PubChem CID 130336849) has the molecular formula C27H24N6O4 and a molecular weight of 496.53 g/mol. Its IUPAC name is 3-[6-[[[(6S,7aS)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl]amino]methyl]-2-pyridinyl]benzonitrile.
| Compound Name | 3-[6-[[[(6S,7aS)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl]amino]methyl]-2-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 130336849 |
| Molecular Formula | C27H24N6O4 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 3-[6-[[[(6S,7aS)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl]amino]methyl]-2-pyridinyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cccc(CN[C@H]3CCC4[C@H](C3)OC(=O)N4c3ccc4c(n3)NC(=O)CO4)n2)c1 |
| InChI | InChI=1S/C27H24N6O4/c28-13-16-3-1-4-17(11-16)20-6-2-5-19(30-20)14-29-18-7-8-21-23(12-18)37-27(35)33(21)24-10-9-22-26(31-24)32-25(34)15-36-22/h1-6,9-11,18,21,23,29H,7-8,12,14-15H2,(H,31,32,34)/t18-,21?,23-/m0/s1 |
| InChIKey | SFJXUDAGYIGHQA-IAZWUMQMSA-N |
| XLogP | 3.38 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |