C26H22N6O5 — CID 137200762
6-[3-[[(4aR,7aR)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-e][1,3]oxazin-6-yl]methyl]-2-hydroxyphenyl]pyridine-2-carbonitrile (PubChem CID 137200762) has the molecular formula C26H22N6O5 and a molecular weight of 498.50 g/mol. Its IUPAC name is 6-[3-[[(4aR,7aR)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-e][1,3]oxazin-6-yl]methyl]-2-hydroxyphenyl]pyridine-2-carbonitrile.
| Compound Name | 6-[3-[[(4aR,7aR)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-e][1,3]oxazin-6-yl]methyl]-2-hydroxyphenyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 137200762 |
| Molecular Formula | C26H22N6O5 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 6-[3-[[(4aR,7aR)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-e][1,3]oxazin-6-yl]methyl]-2-hydroxyphenyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(-c2cccc(CN3C[C@@H]4CN(c5ccc6c(n5)NC(=O)CO6)C(=O)O[C@H]4C3)c2O)n1 |
| InChI | InChI=1S/C26H22N6O5/c27-9-17-4-2-6-19(28-17)18-5-1-3-15(24(18)34)10-31-11-16-12-32(26(35)37-21(16)13-31)22-8-7-20-25(29-22)30-23(33)14-36-20/h1-8,16,21,34H,10-14H2,(H,29,30,33)/t16-,21+/m1/s1 |
| InChIKey | GLXBKEQRRSWEPO-IERDGZPVSA-N |
| XLogP | 2.51 |
| TPSA | 140.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|