C27H33N5O — CID 130337882
1-[3-[1-ethyl-5-[[(1-methylpiperidin-4-yl)amino]methyl]indol-2-yl]prop-2-ynyl]-3-phenylurea (PubChem CID 130337882) has the molecular formula C27H33N5O and a molecular weight of 443.60 g/mol. Its IUPAC name is 1-[3-[1-ethyl-5-[[(1-methylpiperidin-4-yl)amino]methyl]indol-2-yl]prop-2-ynyl]-3-phenylurea.
| Compound Name | 1-[3-[1-ethyl-5-[[(1-methylpiperidin-4-yl)amino]methyl]indol-2-yl]prop-2-ynyl]-3-phenylurea |
|---|---|
| PubChem CID | 130337882 |
| Molecular Formula | C27H33N5O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 1-[3-[1-ethyl-5-[[(1-methylpiperidin-4-yl)amino]methyl]indol-2-yl]prop-2-ynyl]-3-phenylurea |
| SMILES | CCn1c(C#CCNC(=O)Nc2ccccc2)cc2cc(CNC3CCN(C)CC3)ccc21 |
| InChI | InChI=1S/C27H33N5O/c1-3-32-25(10-7-15-28-27(33)30-24-8-5-4-6-9-24)19-22-18-21(11-12-26(22)32)20-29-23-13-16-31(2)17-14-23/h4-6,8-9,11-12,18-19,23,29H,3,13-17,20H2,1-2H3,(H2,28,30,33) |
| InChIKey | REKBAADLLURZEY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|