C24H26FN3O — CID 176572719
N-[[1-ethyl-2-[2-(4-fluoroanilino)ethynyl]indol-5-yl]methyl]oxan-4-amine (PubChem CID 176572719) has the molecular formula C24H26FN3O and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[[1-ethyl-2-[2-(4-fluoroanilino)ethynyl]indol-5-yl]methyl]oxan-4-amine.
| Compound Name | N-[[1-ethyl-2-[2-(4-fluoroanilino)ethynyl]indol-5-yl]methyl]oxan-4-amine |
|---|---|
| PubChem CID | 176572719 |
| Molecular Formula | C24H26FN3O |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-[[1-ethyl-2-[2-(4-fluoroanilino)ethynyl]indol-5-yl]methyl]oxan-4-amine |
| SMILES | CCn1c(C#CNc2ccc(F)cc2)cc2cc(CNC3CCOCC3)ccc21 |
| InChI | InChI=1S/C24H26FN3O/c1-2-28-23(9-12-26-21-6-4-20(25)5-7-21)16-19-15-18(3-8-24(19)28)17-27-22-10-13-29-14-11-22/h3-8,15-16,22,26-27H,2,10-11,13-14,17H2,1H3 |
| InChIKey | YRWSEFXDMUFFNU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|