C20H17N7S — CID 130338641
4-amino-6-[1-(2-phenylpyrido[4,3-e]thiazin-3-yl)ethylamino]pyrimidine-5-carbonitrile (PubChem CID 130338641) has the molecular formula C20H17N7S and a molecular weight of 387.47 g/mol. Its IUPAC name is 4-amino-6-[1-(2-phenylpyrido[4,3-e]thiazin-3-yl)ethylamino]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-[1-(2-phenylpyrido[4,3-e]thiazin-3-yl)ethylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 130338641 |
| Molecular Formula | C20H17N7S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-amino-6-[1-(2-phenylpyrido[4,3-e]thiazin-3-yl)ethylamino]pyrimidine-5-carbonitrile |
| SMILES | CC(Nc1ncnc(N)c1C#N)C1=Cc2ccncc2SN1c1ccccc1 |
| InChI | InChI=1S/C20H17N7S/c1-13(26-20-16(10-21)19(22)24-12-25-20)17-9-14-7-8-23-11-18(14)28-27(17)15-5-3-2-4-6-15/h2-9,11-13H,1H3,(H3,22,24,25,26) |
| InChIKey | RPDRGXLQOWTOOI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|