C17H19N7 — CID 151955106
4-amino-6-[1-[(2S)-1-methyl-3-phenyl-2H-imidazol-2-yl]ethylamino]pyrimidine-5-carbonitrile (PubChem CID 151955106) has the molecular formula C17H19N7 and a molecular weight of 321.39 g/mol. Its IUPAC name is 4-amino-6-[1-[(2S)-1-methyl-3-phenyl-2H-imidazol-2-yl]ethylamino]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-[1-[(2S)-1-methyl-3-phenyl-2H-imidazol-2-yl]ethylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 151955106 |
| Molecular Formula | C17H19N7 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-amino-6-[1-[(2S)-1-methyl-3-phenyl-2H-imidazol-2-yl]ethylamino]pyrimidine-5-carbonitrile |
| SMILES | CC(Nc1ncnc(N)c1C#N)[C@H]1N(C)C=CN1c1ccccc1 |
| InChI | InChI=1S/C17H19N7/c1-12(22-16-14(10-18)15(19)20-11-21-16)17-23(2)8-9-24(17)13-6-4-3-5-7-13/h3-9,11-12,17H,1-2H3,(H3,19,20,21,22)/t12?,17-/m0/s1 |
| InChIKey | TXLRBYVSTYUEER-TYJDENFWSA-N |
| XLogP | 1.98 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |