C20H16ClN7S — CID 130337689
4-amino-6-[1-(8-chloro-2-phenyl-1,2,4-benzothiadiazin-3-yl)ethylamino]pyrimidine-5-carbonitrile (PubChem CID 130337689) has the molecular formula C20H16ClN7S and a molecular weight of 421.92 g/mol. Its IUPAC name is 4-amino-6-[1-(8-chloro-2-phenyl-1,2,4-benzothiadiazin-3-yl)ethylamino]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-[1-(8-chloro-2-phenyl-1,2,4-benzothiadiazin-3-yl)ethylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 130337689 |
| Molecular Formula | C20H16ClN7S |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 4-amino-6-[1-(8-chloro-2-phenyl-1,2,4-benzothiadiazin-3-yl)ethylamino]pyrimidine-5-carbonitrile |
| SMILES | CC(Nc1ncnc(N)c1C#N)C1=Nc2cccc(Cl)c2SN1c1ccccc1 |
| InChI | InChI=1S/C20H16ClN7S/c1-12(26-19-14(10-22)18(23)24-11-25-19)20-27-16-9-5-8-15(21)17(16)29-28(20)13-6-3-2-4-7-13/h2-9,11-12H,1H3,(H3,23,24,25,26) |
| InChIKey | PFWJJFNWOTZNCW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|