C18H28O3 — CID 130339222
1,2,4b-trimethyl-3-oxo-4,4a,5,6,7,8,8a,9,10,10a-decahydro-1H-phenanthrene-2-carboxylic acid (PubChem CID 130339222) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1,2,4b-trimethyl-3-oxo-4,4a,5,6,7,8,8a,9,10,10a-decahydro-1H-phenanthrene-2-carboxylic acid.
| Compound Name | 1,2,4b-trimethyl-3-oxo-4,4a,5,6,7,8,8a,9,10,10a-decahydro-1H-phenanthrene-2-carboxylic acid |
|---|---|
| PubChem CID | 130339222 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 1,2,4b-trimethyl-3-oxo-4,4a,5,6,7,8,8a,9,10,10a-decahydro-1H-phenanthrene-2-carboxylic acid |
| SMILES | CC1C2CCC3CCCCC3(C)C2CC(=O)C1(C)C(=O)O |
| InChI | InChI=1S/C18H28O3/c1-11-13-8-7-12-6-4-5-9-17(12,2)14(13)10-15(19)18(11,3)16(20)21/h11-14H,4-10H2,1-3H3,(H,20,21) |
| InChIKey | AMKUKDPBSOGODS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|