C23H21FN6OS — CID 130342575
1-[(3R)-3-[4-amino-3-[5-(3-fluorophenyl)thiophen-2-yl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 130342575) has the molecular formula C23H21FN6OS and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-3-[5-(3-fluorophenyl)thiophen-2-yl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[4-amino-3-[5-(3-fluorophenyl)thiophen-2-yl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130342575 |
| Molecular Formula | C23H21FN6OS |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 1-[(3R)-3-[4-amino-3-[5-(3-fluorophenyl)thiophen-2-yl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(-c4cccc(F)c4)s3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C23H21FN6OS/c1-2-19(31)29-10-4-7-16(12-29)30-23-20(22(25)26-13-27-23)21(28-30)18-9-8-17(32-18)14-5-3-6-15(24)11-14/h2-3,5-6,8-9,11,13,16H,1,4,7,10,12H2,(H2,25,26,27)/t16-/m1/s1 |
| InChIKey | URPDCGGEJTUAQV-MRXNPFEDSA-N |
| XLogP | 4.29 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|