C21H25N3O3 — CID 130345824
formic acid;3-(3-pyrrolidin-1-ylpropoxy)acridin-1-amine (PubChem CID 130345824) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is formic acid;3-(3-pyrrolidin-1-ylpropoxy)acridin-1-amine.
| Compound Name | formic acid;3-(3-pyrrolidin-1-ylpropoxy)acridin-1-amine |
|---|---|
| PubChem CID | 130345824 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | formic acid;3-(3-pyrrolidin-1-ylpropoxy)acridin-1-amine |
| SMILES | Nc1cc(OCCCN2CCCC2)cc2nc3ccccc3cc12.O=CO |
| InChI | InChI=1S/C20H23N3O.CH2O2/c21-18-13-16(24-11-5-10-23-8-3-4-9-23)14-20-17(18)12-15-6-1-2-7-19(15)22-20;2-1-3/h1-2,6-7,12-14H,3-5,8-11,21H2;1H,(H,2,3) |
| InChIKey | KRZPKJPBYPZKIH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|