C27H24F3N3O2 — CID 161026230
1-[3-(2-pyrrolidin-1-ylethoxy)-4-(trifluoromethyl)phenyl]acridine-3-carboxamide (PubChem CID 161026230) has the molecular formula C27H24F3N3O2 and a molecular weight of 479.50 g/mol. Its IUPAC name is 1-[3-(2-pyrrolidin-1-ylethoxy)-4-(trifluoromethyl)phenyl]acridine-3-carboxamide.
| Compound Name | 1-[3-(2-pyrrolidin-1-ylethoxy)-4-(trifluoromethyl)phenyl]acridine-3-carboxamide |
|---|---|
| PubChem CID | 161026230 |
| Molecular Formula | C27H24F3N3O2 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 1-[3-(2-pyrrolidin-1-ylethoxy)-4-(trifluoromethyl)phenyl]acridine-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(C(F)(F)F)c(OCCN3CCCC3)c2)c2cc3ccccc3nc2c1 |
| InChI | InChI=1S/C27H24F3N3O2/c28-27(29,30)22-8-7-17(16-25(22)35-12-11-33-9-3-4-10-33)20-14-19(26(31)34)15-24-21(20)13-18-5-1-2-6-23(18)32-24/h1-2,5-8,13-16H,3-4,9-12H2,(H2,31,34) |
| InChIKey | SQANLWFUVBUTTH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|