C25H26F3N5O2 — CID 142781401
N'-(pyridin-4-ylmethyl)-2-[3-(2-pyrrolidin-1-ylethoxy)-4-(trifluoromethyl)phenyl]pyridine-3-carbohydrazide (PubChem CID 142781401) has the molecular formula C25H26F3N5O2 and a molecular weight of 485.51 g/mol. Its IUPAC name is N'-(pyridin-4-ylmethyl)-2-[3-(2-pyrrolidin-1-ylethoxy)-4-(trifluoromethyl)phenyl]pyridine-3-carbohydrazide.
| Compound Name | N'-(pyridin-4-ylmethyl)-2-[3-(2-pyrrolidin-1-ylethoxy)-4-(trifluoromethyl)phenyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 142781401 |
| Molecular Formula | C25H26F3N5O2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N'-(pyridin-4-ylmethyl)-2-[3-(2-pyrrolidin-1-ylethoxy)-4-(trifluoromethyl)phenyl]pyridine-3-carbohydrazide |
| SMILES | O=C(NNCc1ccncc1)c1cccnc1-c1ccc(C(F)(F)F)c(OCCN2CCCC2)c1 |
| InChI | InChI=1S/C25H26F3N5O2/c26-25(27,28)21-6-5-19(16-22(21)35-15-14-33-12-1-2-13-33)23-20(4-3-9-30-23)24(34)32-31-17-18-7-10-29-11-8-18/h3-11,16,31H,1-2,12-15,17H2,(H,32,34) |
| InChIKey | DGHXQKVEZYEOQC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|