C18H17F3N4O — CID 150369278
4-(2-pyrrolidin-1-ylethoxy)-2-(trifluoromethyl)pyrimido[4,5-b]quinoline (PubChem CID 150369278) has the molecular formula C18H17F3N4O and a molecular weight of 362.36 g/mol. Its IUPAC name is 4-(2-pyrrolidin-1-ylethoxy)-2-(trifluoromethyl)pyrimido[4,5-b]quinoline.
| Compound Name | 4-(2-pyrrolidin-1-ylethoxy)-2-(trifluoromethyl)pyrimido[4,5-b]quinoline |
|---|---|
| PubChem CID | 150369278 |
| Molecular Formula | C18H17F3N4O |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 4-(2-pyrrolidin-1-ylethoxy)-2-(trifluoromethyl)pyrimido[4,5-b]quinoline |
| SMILES | FC(F)(F)c1nc(OCCN2CCCC2)c2cc3ccccc3nc2n1 |
| InChI | InChI=1S/C18H17F3N4O/c19-18(20,21)17-23-15-13(11-12-5-1-2-6-14(12)22-15)16(24-17)26-10-9-25-7-3-4-8-25/h1-2,5-6,11H,3-4,7-10H2 |
| InChIKey | GXJNXAJLTZUJHH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|