C11H20N2 — CID 130346380
N-[(Z)-3,3-dimethyl-2-(methylideneamino)hex-1-enyl]ethanimine (PubChem CID 130346380) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is N-[(Z)-3,3-dimethyl-2-(methylideneamino)hex-1-enyl]ethanimine.
| Compound Name | N-[(Z)-3,3-dimethyl-2-(methylideneamino)hex-1-enyl]ethanimine |
|---|---|
| PubChem CID | 130346380 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N-[(Z)-3,3-dimethyl-2-(methylideneamino)hex-1-enyl]ethanimine |
| SMILES | C=N/C(=C\N=C\C)C(C)(C)CCC |
| InChI | InChI=1S/C11H20N2/c1-6-8-11(3,4)10(12-5)9-13-7-2/h7,9H,5-6,8H2,1-4H3/b10-9-,13-7+ |
| InChIKey | PWACLFOKUMTSLV-QLNUPNCESA-N |
| XLogP | 3.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|