C14H8F6N4 — CID 130346743
(E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-methylprop-2-enenitrile (PubChem CID 130346743) has the molecular formula C14H8F6N4 and a molecular weight of 346.23 g/mol. Its IUPAC name is (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-methylprop-2-enenitrile.
| Compound Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-methylprop-2-enenitrile |
|---|---|
| PubChem CID | 130346743 |
| Molecular Formula | C14H8F6N4 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-methylprop-2-enenitrile |
| SMILES | C/C(C#N)=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C14H8F6N4/c1-8(5-21)6-24-7-22-12(23-24)9-2-10(13(15,16)17)4-11(3-9)14(18,19)20/h2-4,6-7H,1H3/b8-6+ |
| InChIKey | BTGFOVPIHBFCMP-SOFGYWHQSA-N |
| XLogP | 4.37 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|