C22H27O4P — CID 130346880
bis[(3E,5Z)-hepta-1,3,5-trien-4-yl] [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl] phosphate (PubChem CID 130346880) has the molecular formula C22H27O4P and a molecular weight of 386.43 g/mol. Its IUPAC name is bis[(3E,5Z)-hepta-1,3,5-trien-4-yl] [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl] phosphate.
| Compound Name | bis[(3E,5Z)-hepta-1,3,5-trien-4-yl] [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl] phosphate |
|---|---|
| PubChem CID | 130346880 |
| Molecular Formula | C22H27O4P |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | bis[(3E,5Z)-hepta-1,3,5-trien-4-yl] [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl] phosphate |
| SMILES | C=C/C=C\C(=C/C=C)OP(=O)(OC(/C=C\C)=C/C=C)OC(/C=C\C)=C/C=C |
| InChI | InChI=1S/C22H27O4P/c1-7-13-19-22(18-12-6)26-27(23,24-20(14-8-2)15-9-3)25-21(16-10-4)17-11-5/h7-19H,1-2,4,6H2,3,5H3/b15-9-,17-11-,19-13-,20-14+,21-16+,22-18+ |
| InChIKey | RUBBSWXOFVHDIJ-HMYSDSTOSA-N |
| XLogP | 7.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|