C25H24N2O5 — CID 130348249
[(5S)-11-[amino(hydroxy)methyl]-5,6-dihydrobenzo[b][1]benzazepin-5-yl] (2R)-2-acetyloxy-2-phenylacetate (PubChem CID 130348249) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is [(5S)-11-[amino(hydroxy)methyl]-5,6-dihydrobenzo[b][1]benzazepin-5-yl] (2R)-2-acetyloxy-2-phenylacetate.
| Compound Name | [(5S)-11-[amino(hydroxy)methyl]-5,6-dihydrobenzo[b][1]benzazepin-5-yl] (2R)-2-acetyloxy-2-phenylacetate |
|---|---|
| PubChem CID | 130348249 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [(5S)-11-[amino(hydroxy)methyl]-5,6-dihydrobenzo[b][1]benzazepin-5-yl] (2R)-2-acetyloxy-2-phenylacetate |
| SMILES | CC(=O)O[C@@H](C(=O)O[C@H]1Cc2ccccc2N(C(N)O)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O5/c1-16(28)31-23(17-9-3-2-4-10-17)24(29)32-22-15-18-11-5-7-13-20(18)27(25(26)30)21-14-8-6-12-19(21)22/h2-14,22-23,25,30H,15,26H2,1H3/t22-,23+,25?/m0/s1 |
| InChIKey | YVPLYKMAFGHUTM-YGHPRADISA-N |
| XLogP | 3.50 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|