C34H31N3O4 — CID 163750392
2-O-[(5R)-11-cyano-5,6-dihydrobenzo[b][1]benzazepin-5-yl] 1-O-[[ethyl-[(1S)-1-phenylethyl]amino]methyl] benzene-1,2-dicarboxylate (PubChem CID 163750392) has the molecular formula C34H31N3O4 and a molecular weight of 545.64 g/mol. Its IUPAC name is 2-O-[(5R)-11-cyano-5,6-dihydrobenzo[b][1]benzazepin-5-yl] 1-O-[[ethyl-[(1S)-1-phenylethyl]amino]methyl] benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[(5R)-11-cyano-5,6-dihydrobenzo[b][1]benzazepin-5-yl] 1-O-[[ethyl-[(1S)-1-phenylethyl]amino]methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 163750392 |
| Molecular Formula | C34H31N3O4 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 2-O-[(5R)-11-cyano-5,6-dihydrobenzo[b][1]benzazepin-5-yl] 1-O-[[ethyl-[(1S)-1-phenylethyl]amino]methyl] benzene-1,2-dicarboxylate |
| SMILES | CCN(COC(=O)c1ccccc1C(=O)O[C@@H]1Cc2ccccc2N(C#N)c2ccccc21)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C34H31N3O4/c1-3-36(24(2)25-13-5-4-6-14-25)23-40-33(38)27-16-8-9-17-28(27)34(39)41-32-21-26-15-7-11-19-30(26)37(22-35)31-20-12-10-18-29(31)32/h4-20,24,32H,3,21,23H2,1-2H3/t24-,32+/m0/s1 |
| InChIKey | LPMHXLQFRXLENP-NRUKRWIHSA-N |
| XLogP | 6.96 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|