About 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile
5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile (PubChem CID 89299148) has the molecular formula C15H13N3
and a molecular weight of 235.29 g/mol. Its IUPAC name is 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile |
| PubChem CID | 89299148 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile |
| SMILES | N#CN1c2ccccc2CC(N)c2ccccc21 |
| InChI | InChI=1S/C15H13N3/c16-10-18-14-7-3-1-5-11(14)9-13(17)12-6-2-4-8-15(12)18/h1-8,13H,9,17H2 |
| InChIKey | CQESNLIBSOCSQH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile?
The IUPAC name of 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile (CID 89299148) is 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile.
What is the SMILES notation for 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile?
The canonical SMILES for 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile is N#CN1c2ccccc2CC(N)c2ccccc21.
What is the InChIKey of 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile?
The InChIKey is CQESNLIBSOCSQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3/c16-10-18-14-7-3-1-5-11(14)9-13(17)12-6-2-4-8-15(12)18/h1-8,13H,9,17H2.
What are the key properties of 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile?
5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile has a molecular weight of 235.29 g/mol, XLogP of 2.86, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-5,6-dihydrobenzo[b][1]benzazepine-11-carbonitrile is sourced from PubChem (CID 89299148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).