C30H23N3O4 — CID 143232791
2-O-(benzylamino) 1-O-(11-cyano-5,6-dihydrobenzo[b][1]benzazepin-5-yl) benzene-1,2-dicarboxylate (PubChem CID 143232791) has the molecular formula C30H23N3O4 and a molecular weight of 489.53 g/mol. Its IUPAC name is 2-O-(benzylamino) 1-O-(11-cyano-5,6-dihydrobenzo[b][1]benzazepin-5-yl) benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(benzylamino) 1-O-(11-cyano-5,6-dihydrobenzo[b][1]benzazepin-5-yl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 143232791 |
| Molecular Formula | C30H23N3O4 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 2-O-(benzylamino) 1-O-(11-cyano-5,6-dihydrobenzo[b][1]benzazepin-5-yl) benzene-1,2-dicarboxylate |
| SMILES | N#CN1c2ccccc2CC(OC(=O)c2ccccc2C(=O)ONCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C30H23N3O4/c31-20-33-26-16-8-4-12-22(26)18-28(25-15-7-9-17-27(25)33)36-29(34)23-13-5-6-14-24(23)30(35)37-32-19-21-10-2-1-3-11-21/h1-17,28,32H,18-19H2 |
| InChIKey | MLVVLMOBDCPIAY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|