C22H17ClN2O3 — CID 10222152
(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) 2-chlorobenzoate (PubChem CID 10222152) has the molecular formula C22H17ClN2O3 and a molecular weight of 392.84 g/mol. Its IUPAC name is (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) 2-chlorobenzoate.
| Compound Name | (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) 2-chlorobenzoate |
|---|---|
| PubChem CID | 10222152 |
| Molecular Formula | C22H17ClN2O3 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) 2-chlorobenzoate |
| SMILES | NC(=O)N1c2ccccc2CC(OC(=O)c2ccccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C22H17ClN2O3/c23-17-10-4-2-8-15(17)21(26)28-20-13-14-7-1-5-11-18(14)25(22(24)27)19-12-6-3-9-16(19)20/h1-12,20H,13H2,(H2,24,27) |
| InChIKey | IGMDTBULADXOOS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |