C17H16N2O3 — CID 121244798
[(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate (PubChem CID 121244798) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate.
| Compound Name | [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate |
|---|---|
| PubChem CID | 121244798 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate |
| SMILES | NC(=O)N1c2ccccc2C[C@H](COC=O)c2ccccc21 |
| InChI | InChI=1S/C17H16N2O3/c18-17(21)19-15-7-3-1-5-12(15)9-13(10-22-11-20)14-6-2-4-8-16(14)19/h1-8,11,13H,9-10H2,(H2,18,21)/t13-/m1/s1 |
| InChIKey | NUBHVKKZODOTDF-CYBMUJFWSA-N |
| XLogP | 2.72 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|