About [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate
[(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate (PubChem CID 121244798) has the molecular formula C17H16N2O3
and a molecular weight of 296.33 g/mol. Its IUPAC name is [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate.
Molecular Properties
| Compound Name | [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate |
| PubChem CID | 121244798 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate |
| SMILES | NC(=O)N1c2ccccc2C[C@H](COC=O)c2ccccc21 |
| InChI | InChI=1S/C17H16N2O3/c18-17(21)19-15-7-3-1-5-12(15)9-13(10-22-11-20)14-6-2-4-8-16(14)19/h1-8,11,13H,9-10H2,(H2,18,21)/t13-/m1/s1 |
| InChIKey | NUBHVKKZODOTDF-CYBMUJFWSA-N |
| XLogP | 2.72 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate?
The IUPAC name of [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate (CID 121244798) is [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate.
What is the SMILES notation for [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate?
The canonical SMILES for [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate is NC(=O)N1c2ccccc2C[C@H](COC=O)c2ccccc21.
What is the InChIKey of [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate?
The InChIKey is NUBHVKKZODOTDF-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H16N2O3/c18-17(21)19-15-7-3-1-5-12(15)9-13(10-22-11-20)14-6-2-4-8-16(14)19/h1-8,11,13H,9-10H2,(H2,18,21)/t13-/m1/s1.
What are the key properties of [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate?
[(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate has a molecular weight of 296.33 g/mol, XLogP of 2.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl]methyl formate is sourced from PubChem (CID 121244798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).