About 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide
5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide (PubChem CID 14306227) has the molecular formula C16H13F3N2O
and a molecular weight of 306.29 g/mol. Its IUPAC name is 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide.
Molecular Properties
| Compound Name | 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide |
| PubChem CID | 14306227 |
| Molecular Formula | C16H13F3N2O |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide |
| SMILES | NC(=O)N1c2ccccc2CC(C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C16H13F3N2O/c17-16(18,19)12-9-10-5-1-3-7-13(10)21(15(20)22)14-8-4-2-6-11(12)14/h1-8,12H,9H2,(H2,20,22) |
| InChIKey | BWYYFWITWGKBBZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide?
The IUPAC name of 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide (CID 14306227) is 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide.
What is the SMILES notation for 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide?
The canonical SMILES for 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide is NC(=O)N1c2ccccc2CC(C(F)(F)F)c2ccccc21.
What is the InChIKey of 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide?
The InChIKey is BWYYFWITWGKBBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3N2O/c17-16(18,19)12-9-10-5-1-3-7-13(10)21(15(20)22)14-8-4-2-6-11(12)14/h1-8,12H,9H2,(H2,20,22).
What are the key properties of 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide?
5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide has a molecular weight of 306.29 g/mol, XLogP of 4.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide is sourced from PubChem (CID 14306227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).