C28H38N4O2S — CID 130349135
4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,2,6,6-tetramethyl-1-oxothian-4-yl)phenyl]-2,3-dihydro-1H-imidazole-2-carboxamide (PubChem CID 130349135) has the molecular formula C28H38N4O2S and a molecular weight of 494.71 g/mol. Its IUPAC name is 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,2,6,6-tetramethyl-1-oxothian-4-yl)phenyl]-2,3-dihydro-1H-imidazole-2-carboxamide.
| Compound Name | 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,2,6,6-tetramethyl-1-oxothian-4-yl)phenyl]-2,3-dihydro-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 130349135 |
| Molecular Formula | C28H38N4O2S |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,2,6,6-tetramethyl-1-oxothian-4-yl)phenyl]-2,3-dihydro-1H-imidazole-2-carboxamide |
| SMILES | CC1(C)CC=C(c2cc(C3CC(C)(C)S(=O)C(C)(C)C3)ccc2NC(=O)C2NC=C(C#N)N2)CC1 |
| InChI | InChI=1S/C28H38N4O2S/c1-26(2)11-9-18(10-12-26)22-13-19(20-14-27(3,4)35(34)28(5,6)15-20)7-8-23(22)32-25(33)24-30-17-21(16-29)31-24/h7-9,13,17,20,24,30-31H,10-12,14-15H2,1-6H3,(H,32,33) |
| InChIKey | ITYHMWDTMBFIMH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |