C24H26ClN3O3 — CID 130350207
ethyl 1-amino-9-chloro-7-[4-(pyrrolidine-1-carbonyl)phenyl]-2,3-dihydro-1-benzazepine-4-carboxylate (PubChem CID 130350207) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is ethyl 1-amino-9-chloro-7-[4-(pyrrolidine-1-carbonyl)phenyl]-2,3-dihydro-1-benzazepine-4-carboxylate.
| Compound Name | ethyl 1-amino-9-chloro-7-[4-(pyrrolidine-1-carbonyl)phenyl]-2,3-dihydro-1-benzazepine-4-carboxylate |
|---|---|
| PubChem CID | 130350207 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | ethyl 1-amino-9-chloro-7-[4-(pyrrolidine-1-carbonyl)phenyl]-2,3-dihydro-1-benzazepine-4-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cc(-c3ccc(C(=O)N4CCCC4)cc3)cc(Cl)c2N(N)CC1 |
| InChI | InChI=1S/C24H26ClN3O3/c1-2-31-24(30)18-9-12-28(26)22-20(13-18)14-19(15-21(22)25)16-5-7-17(8-6-16)23(29)27-10-3-4-11-27/h5-8,13-15H,2-4,9-12,26H2,1H3 |
| InChIKey | HSUKGGRKPYRWAR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|