C15H14N4O3S — CID 130350451
2-amino-N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidine-7-carboxamide (PubChem CID 130350451) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-amino-N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | 2-amino-N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 130350451 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-amino-N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidine-7-carboxamide |
| SMILES | COc1ccc(NC(=O)c2csc3cnc(N)nc23)cc1OC |
| InChI | InChI=1S/C15H14N4O3S/c1-21-10-4-3-8(5-11(10)22-2)18-14(20)9-7-23-12-6-17-15(16)19-13(9)12/h3-7H,1-2H3,(H,18,20)(H2,16,17,19) |
| InChIKey | MTFWLIGDCKPYRO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |