C5H4F4O6S2 — CID 130351250
(4S)-1,4,6,9-tetrafluoro-2,7-dioxa-3λ6,8λ6-dithiaspiro[4.4]nonane 3,3,8,8-tetraoxide (PubChem CID 130351250) has the molecular formula C5H4F4O6S2 and a molecular weight of 300.21 g/mol. Its IUPAC name is (4S)-1,4,6,9-tetrafluoro-2,7-dioxa-3λ6,8λ6-dithiaspiro[4.4]nonane 3,3,8,8-tetraoxide.
| Compound Name | (4S)-1,4,6,9-tetrafluoro-2,7-dioxa-3λ6,8λ6-dithiaspiro[4.4]nonane 3,3,8,8-tetraoxide |
|---|---|
| PubChem CID | 130351250 |
| Molecular Formula | C5H4F4O6S2 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 299.94 |
| IUPAC Name | (4S)-1,4,6,9-tetrafluoro-2,7-dioxa-3λ6,8λ6-dithiaspiro[4.4]nonane 3,3,8,8-tetraoxide |
| SMILES | O=S1(=O)OC(F)C2(C(F)OS(=O)(=O)[C@@H]2F)C1F |
| InChI | InChI=1S/C5H4F4O6S2/c6-1-5(3(8)16(10,11)14-1)2(7)15-17(12,13)4(5)9/h1-4H/t1?,2?,3-,4?,5?/m0/s1 |
| InChIKey | HGNZJEJMPDGDCO-BQKPUXPDSA-N |
| XLogP | -0.12 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|