C4H4F2O7S2 — CID 130334798
4,9-difluoro-1,3,6-trioxa-2λ6,7λ6-dithiaspiro[4.4]nonane 2,2,7,7-tetraoxide (PubChem CID 130334798) has the molecular formula C4H4F2O7S2 and a molecular weight of 266.20 g/mol. Its IUPAC name is 4,9-difluoro-1,3,6-trioxa-2λ6,7λ6-dithiaspiro[4.4]nonane 2,2,7,7-tetraoxide.
| Compound Name | 4,9-difluoro-1,3,6-trioxa-2λ6,7λ6-dithiaspiro[4.4]nonane 2,2,7,7-tetraoxide |
|---|---|
| PubChem CID | 130334798 |
| Molecular Formula | C4H4F2O7S2 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 265.94 |
| IUPAC Name | 4,9-difluoro-1,3,6-trioxa-2λ6,7λ6-dithiaspiro[4.4]nonane 2,2,7,7-tetraoxide |
| SMILES | O=S1(=O)CC(F)C2(O1)OS(=O)(=O)OC2F |
| InChI | InChI=1S/C4H4F2O7S2/c5-2-1-14(7,8)12-4(2)3(6)11-15(9,10)13-4/h2-3H,1H2 |
| InChIKey | JHYCQKKCCIMUNZ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|