C17H21N — CID 130351260
(2E,3Z)-3-but-3-enylidene-2-ethylidene-4-methyl-6,7-dihydro-5H-cyclohepta[b]pyridine (PubChem CID 130351260) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is (2E,3Z)-3-but-3-enylidene-2-ethylidene-4-methyl-6,7-dihydro-5H-cyclohepta[b]pyridine.
| Compound Name | (2E,3Z)-3-but-3-enylidene-2-ethylidene-4-methyl-6,7-dihydro-5H-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 130351260 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (2E,3Z)-3-but-3-enylidene-2-ethylidene-4-methyl-6,7-dihydro-5H-cyclohepta[b]pyridine |
| SMILES | C=CC/C=c1/c(C)c2c(n/c1=C/C)C=CCCC2 |
| InChI | InChI=1S/C17H21N/c1-4-6-10-14-13(3)15-11-8-7-9-12-17(15)18-16(14)5-2/h4-5,9-10,12H,1,6-8,11H2,2-3H3/b14-10-,16-5+ |
| InChIKey | LPCZPDMFUNWHRR-JBZWJKSHSA-N |
| XLogP | 2.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|