C21H22N4O4S — CID 130356236
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(2-methyl-1,3-benzoxazol-5-yl)sulfamoyl]urea (PubChem CID 130356236) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(2-methyl-1,3-benzoxazol-5-yl)sulfamoyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(2-methyl-1,3-benzoxazol-5-yl)sulfamoyl]urea |
|---|---|
| PubChem CID | 130356236 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(2-methyl-1,3-benzoxazol-5-yl)sulfamoyl]urea |
| SMILES | Cc1nc2cc(NS(=O)(=O)NC(=O)Nc3c4c(cc5c3CCC5)CCC4)ccc2o1 |
| InChI | InChI=1S/C21H22N4O4S/c1-12-22-18-11-15(8-9-19(18)29-12)24-30(27,28)25-21(26)23-20-16-6-2-4-13(16)10-14-5-3-7-17(14)20/h8-11,24H,2-7H2,1H3,(H2,23,25,26) |
| InChIKey | FHVLHSCMTGGGOB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |