C7H9NO2 — CID 130356457
(1E,3Z)-2-methoxy-1-nitrosohexa-1,3,5-triene (PubChem CID 130356457) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (1E,3Z)-2-methoxy-1-nitrosohexa-1,3,5-triene.
| Compound Name | (1E,3Z)-2-methoxy-1-nitrosohexa-1,3,5-triene |
|---|---|
| PubChem CID | 130356457 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (1E,3Z)-2-methoxy-1-nitrosohexa-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/N=O)OC |
| InChI | InChI=1S/C7H9NO2/c1-3-4-5-7(10-2)6-8-9/h3-6H,1H2,2H3/b5-4-,7-6+ |
| InChIKey | FJZPDFFWUZARAL-SCFJQAPRSA-N |
| XLogP | 1.98 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|