C10H15NO2 — CID 89366755
(1Z,3E)-3-butoxy-1-nitrosohexa-1,3,5-triene (PubChem CID 89366755) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is (1Z,3E)-3-butoxy-1-nitrosohexa-1,3,5-triene.
| Compound Name | (1Z,3E)-3-butoxy-1-nitrosohexa-1,3,5-triene |
|---|---|
| PubChem CID | 89366755 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (1Z,3E)-3-butoxy-1-nitrosohexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C/N=O)OCCCC |
| InChI | InChI=1S/C10H15NO2/c1-3-5-9-13-10(6-4-2)7-8-11-12/h4,6-8H,2-3,5,9H2,1H3/b8-7-,10-6+ |
| InChIKey | QHFAWGLCRMLNFD-SDHBEMGISA-N |
| XLogP | 3.15 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|