C8H14NO2+ — CID 144703328
[(1Z,3E)-3-ethoxyhexa-1,3,5-trienyl]-hydroxyazanium (PubChem CID 144703328) has the molecular formula C8H14NO2+ and a molecular weight of 156.20 g/mol. Its IUPAC name is [(1Z,3E)-3-ethoxyhexa-1,3,5-trienyl]-hydroxyazanium.
| Compound Name | [(1Z,3E)-3-ethoxyhexa-1,3,5-trienyl]-hydroxyazanium |
|---|---|
| PubChem CID | 144703328 |
| Molecular Formula | C8H14NO2+ |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | [(1Z,3E)-3-ethoxyhexa-1,3,5-trienyl]-hydroxyazanium |
| SMILES | C=C/C=C(\C=C/[NH2+]O)OCC |
| InChI | InChI=1S/C8H13NO2/c1-3-5-8(11-4-2)6-7-9-10/h3,5-7,9-10H,1,4H2,2H3/p+1/b7-6-,8-5+ |
| InChIKey | RYCSJXKDIRWCEZ-WNXMRAAYSA-O |
| XLogP | 0.56 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|