C9H17NO — CID 144746928
ethane;(1Z,3E)-3-methoxyhexa-1,3,5-trien-1-amine (PubChem CID 144746928) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is ethane;(1Z,3E)-3-methoxyhexa-1,3,5-trien-1-amine.
| Compound Name | ethane;(1Z,3E)-3-methoxyhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 144746928 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | ethane;(1Z,3E)-3-methoxyhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)OC.CC |
| InChI | InChI=1S/C7H11NO.C2H6/c1-3-4-7(9-2)5-6-8;1-2/h3-6H,1,8H2,2H3;1-2H3/b6-5-,7-4+; |
| InChIKey | GFIVWHUSDOZBGJ-BIFKCLKRSA-N |
| XLogP | 2.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|